C11H10Cl2N4 — CID 81035859
3,6-dichloro-N-(3,5-dimethylphenyl)-1,2,4-triazin-5-amine (PubChem CID 81035859) has the molecular formula C11H10Cl2N4 and a molecular weight of 269.14 g/mol. Its IUPAC name is 3,6-dichloro-N-(3,5-dimethylphenyl)-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-(3,5-dimethylphenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 81035859 |
| Molecular Formula | C11H10Cl2N4 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3,6-dichloro-N-(3,5-dimethylphenyl)-1,2,4-triazin-5-amine |
| SMILES | Cc1cc(C)cc(Nc2nc(Cl)nnc2Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N4/c1-6-3-7(2)5-8(4-6)14-10-9(12)16-17-11(13)15-10/h3-5H,1-2H3,(H,14,15,17) |
| InChIKey | JRROIZUJESXNGL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |