C12H12Cl2N4 — CID 81035328
3,6-dichloro-N-(4-propylphenyl)-1,2,4-triazin-5-amine (PubChem CID 81035328) has the molecular formula C12H12Cl2N4 and a molecular weight of 283.16 g/mol. Its IUPAC name is 3,6-dichloro-N-(4-propylphenyl)-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-(4-propylphenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 81035328 |
| Molecular Formula | C12H12Cl2N4 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 3,6-dichloro-N-(4-propylphenyl)-1,2,4-triazin-5-amine |
| SMILES | CCCc1ccc(Nc2nc(Cl)nnc2Cl)cc1 |
| InChI | InChI=1S/C12H12Cl2N4/c1-2-3-8-4-6-9(7-5-8)15-11-10(13)17-18-12(14)16-11/h4-7H,2-3H2,1H3,(H,15,16,18) |
| InChIKey | MWEKHTNMPZJUGO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |