C12H13ClN4 — CID 55053308
3-chloro-N-(4-propylphenyl)-1,2,4-triazin-5-amine (PubChem CID 55053308) has the molecular formula C12H13ClN4 and a molecular weight of 248.72 g/mol. Its IUPAC name is 3-chloro-N-(4-propylphenyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-chloro-N-(4-propylphenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 55053308 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-chloro-N-(4-propylphenyl)-1,2,4-triazin-5-amine |
| SMILES | CCCc1ccc(Nc2cnnc(Cl)n2)cc1 |
| InChI | InChI=1S/C12H13ClN4/c1-2-3-9-4-6-10(7-5-9)15-11-8-14-17-12(13)16-11/h4-8H,2-3H2,1H3,(H,15,16,17) |
| InChIKey | RPDDURJONYSOSJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |