C12H7Cl2N5 — CID 81036767
N-(3,6-dichloro-1,2,4-triazin-5-yl)quinolin-6-amine (PubChem CID 81036767) has the molecular formula C12H7Cl2N5 and a molecular weight of 292.13 g/mol. Its IUPAC name is N-(3,6-dichloro-1,2,4-triazin-5-yl)quinolin-6-amine.
| Compound Name | N-(3,6-dichloro-1,2,4-triazin-5-yl)quinolin-6-amine |
|---|---|
| PubChem CID | 81036767 |
| Molecular Formula | C12H7Cl2N5 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | N-(3,6-dichloro-1,2,4-triazin-5-yl)quinolin-6-amine |
| SMILES | Clc1nnc(Cl)c(Nc2ccc3ncccc3c2)n1 |
| InChI | InChI=1S/C12H7Cl2N5/c13-10-11(17-12(14)19-18-10)16-8-3-4-9-7(6-8)2-1-5-15-9/h1-6H,(H,16,17,19) |
| InChIKey | MYOITSDCBXHBJU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |