C15H11ClFN3 — CID 66077251
4-chloro-5-fluoro-1-N-quinolin-6-ylbenzene-1,2-diamine (PubChem CID 66077251) has the molecular formula C15H11ClFN3 and a molecular weight of 287.73 g/mol. Its IUPAC name is 4-chloro-5-fluoro-1-N-quinolin-6-ylbenzene-1,2-diamine.
| Compound Name | 4-chloro-5-fluoro-1-N-quinolin-6-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 66077251 |
| Molecular Formula | C15H11ClFN3 |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-chloro-5-fluoro-1-N-quinolin-6-ylbenzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(F)cc1Nc1ccc2ncccc2c1 |
| InChI | InChI=1S/C15H11ClFN3/c16-11-7-13(18)15(8-12(11)17)20-10-3-4-14-9(6-10)2-1-5-19-14/h1-8,20H,18H2 |
| InChIKey | XYCKNMSZNRIVLL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|