C12H8N4O — CID 115004022
2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde (PubChem CID 115004022) has the molecular formula C12H8N4O and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde.
| Compound Name | 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 115004022 |
| Molecular Formula | C12H8N4O |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde |
| SMILES | O=Cc1cccc2nc(-c3cccnc3)nn12 |
| InChI | InChI=1S/C12H8N4O/c17-8-10-4-1-5-11-14-12(15-16(10)11)9-3-2-6-13-7-9/h1-8H |
| InChIKey | DKELSQOFHOXZHD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|