About 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid
2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid (PubChem CID 115006185) has the molecular formula C8H11NO4S
and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid.
Analyze 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid?
The IUPAC name of 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid (CID 115006185) is 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid.
What is the SMILES notation for 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid?
The canonical SMILES for 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid is O=C(O)C1COC(=O)N1C1CCSC1.
What is the InChIKey of 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid?
The InChIKey is SWPGFFLBYFTGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4S/c10-7(11)6-3-13-8(12)9(6)5-1-2-14-4-5/h5-6H,1-4H2,(H,10,11).
What are the key properties of 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid?
2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid has a molecular weight of 217.25 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3-(thiolan-3-yl)-1,3-oxazolidine-4-carboxylic acid is sourced from PubChem (CID 115006185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).