C11H7NO2S — CID 115007560
7-hydroxy-1H-[1]benzothiolo[3,2-b]pyrrole-2-carbaldehyde (PubChem CID 115007560) has the molecular formula C11H7NO2S and a molecular weight of 217.25 g/mol. Its IUPAC name is 7-hydroxy-1H-[1]benzothiolo[3,2-b]pyrrole-2-carbaldehyde.
| Compound Name | 7-hydroxy-1H-[1]benzothiolo[3,2-b]pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 115007560 |
| Molecular Formula | C11H7NO2S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 7-hydroxy-1H-[1]benzothiolo[3,2-b]pyrrole-2-carbaldehyde |
| SMILES | O=Cc1cc2sc3ccc(O)cc3c2[nH]1 |
| InChI | InChI=1S/C11H7NO2S/c13-5-6-3-10-11(12-6)8-4-7(14)1-2-9(8)15-10/h1-5,12,14H |
| InChIKey | LZQJWXXSYVWWQJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|