C12H9NOS — CID 115007433
5-methyl-1H-[1]benzothiolo[3,2-b]pyrrole-2-carbaldehyde (PubChem CID 115007433) has the molecular formula C12H9NOS and a molecular weight of 215.28 g/mol. Its IUPAC name is 5-methyl-1H-[1]benzothiolo[3,2-b]pyrrole-2-carbaldehyde.
| Compound Name | 5-methyl-1H-[1]benzothiolo[3,2-b]pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 115007433 |
| Molecular Formula | C12H9NOS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 5-methyl-1H-[1]benzothiolo[3,2-b]pyrrole-2-carbaldehyde |
| SMILES | Cc1cccc2c1sc1cc(C=O)[nH]c12 |
| InChI | InChI=1S/C12H9NOS/c1-7-3-2-4-9-11-10(15-12(7)9)5-8(6-14)13-11/h2-6,13H,1H3 |
| InChIKey | QKNTUAFZWMCEOL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|