C14H18O2 — CID 115010714
spiro[3,4-dihydro-2H-naphthalene-1,4'-oxane]-2-ol (PubChem CID 115010714) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is spiro[3,4-dihydro-2H-naphthalene-1,4'-oxane]-2-ol.
| Compound Name | spiro[3,4-dihydro-2H-naphthalene-1,4'-oxane]-2-ol |
|---|---|
| PubChem CID | 115010714 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | spiro[3,4-dihydro-2H-naphthalene-1,4'-oxane]-2-ol |
| SMILES | OC1CCc2ccccc2C12CCOCC2 |
| InChI | InChI=1S/C14H18O2/c15-13-6-5-11-3-1-2-4-12(11)14(13)7-9-16-10-8-14/h1-4,13,15H,5-10H2 |
| InChIKey | ZGKZYZWVGFHGRO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |