C5H7N3 — CID 115011042
5-ethenyl-1-methyl-1,2,4-triazole (PubChem CID 115011042) has the molecular formula C5H7N3 and a molecular weight of 109.13 g/mol. Its IUPAC name is 5-ethenyl-1-methyl-1,2,4-triazole.
| Compound Name | 5-ethenyl-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115011042 |
| Molecular Formula | C5H7N3 |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.06 |
| IUPAC Name | 5-ethenyl-1-methyl-1,2,4-triazole |
| SMILES | C=Cc1ncnn1C |
| InChI | InChI=1S/C5H7N3/c1-3-5-6-4-7-8(5)2/h3-4H,1H2,2H3 |
| InChIKey | SJAUJCQLRCYANB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |