C6H4LiN3 — CID 134971062
lithium 5H-[1,2,4]triazolo[1,5-a]pyridin-5-ide (PubChem CID 134971062) has the molecular formula C6H4LiN3 and a molecular weight of 125.06 g/mol. Its IUPAC name is lithium 5H-[1,2,4]triazolo[1,5-a]pyridin-5-ide.
| Compound Name | lithium 5H-[1,2,4]triazolo[1,5-a]pyridin-5-ide |
|---|---|
| PubChem CID | 134971062 |
| Molecular Formula | C6H4LiN3 |
| Molecular Weight | 125.06 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | lithium 5H-[1,2,4]triazolo[1,5-a]pyridin-5-ide |
| SMILES | [Li+].[c-]1cccc2ncnn12 |
| InChI | InChI=1S/C6H4N3.Li/c1-2-4-9-6(3-1)7-5-8-9;/h1-3,5H;/q-1;+1 |
| InChIKey | UIUNXTLBPGTWDJ-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.06 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|