C9H8LiN3 — CID 58162954
lithium 5-methyl-1-phenyl-1,2,4-triazole (PubChem CID 58162954) has the molecular formula C9H8LiN3 and a molecular weight of 165.12 g/mol. Its IUPAC name is lithium 5-methyl-1-phenyl-1,2,4-triazole.
| Compound Name | lithium 5-methyl-1-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 58162954 |
| Molecular Formula | C9H8LiN3 |
| Molecular Weight | 165.12 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | lithium 5-methyl-1-phenyl-1,2,4-triazole |
| SMILES | Cc1ncnn1-c1[c-]cccc1.[Li+] |
| InChI | InChI=1S/C9H8N3.Li/c1-8-10-7-11-12(8)9-5-3-2-4-6-9;/h2-5,7H,1H3;/q-1;+1 |
| InChIKey | NUEYAAKRKOEDIG-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.12 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|