C9H8N3Pt- — CID 58162916
5-methyl-1-phenyl-1,2,4-triazole;platinum (PubChem CID 58162916) has the molecular formula C9H8N3Pt- and a molecular weight of 353.26 g/mol. Its IUPAC name is 5-methyl-1-phenyl-1,2,4-triazole;platinum.
| Compound Name | 5-methyl-1-phenyl-1,2,4-triazole;platinum |
|---|---|
| PubChem CID | 58162916 |
| Molecular Formula | C9H8N3Pt- |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 5-methyl-1-phenyl-1,2,4-triazole;platinum |
| SMILES | Cc1ncnn1-c1[c-]cccc1.[Pt] |
| InChI | InChI=1S/C9H8N3.Pt/c1-8-10-7-11-12(8)9-5-3-2-4-6-9;/h2-5,7H,1H3;/q-1; |
| InChIKey | FWTGUAJEAMCKRN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|