C6H11F2N — CID 115011284
1-(2,2-difluoroethyl)cyclobutan-1-amine (PubChem CID 115011284) has the molecular formula C6H11F2N and a molecular weight of 135.16 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)cyclobutan-1-amine.
| Compound Name | 1-(2,2-difluoroethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 115011284 |
| Molecular Formula | C6H11F2N |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 1-(2,2-difluoroethyl)cyclobutan-1-amine |
| SMILES | NC1(CC(F)F)CCC1 |
| InChI | InChI=1S/C6H11F2N/c7-5(8)4-6(9)2-1-3-6/h5H,1-4,9H2 |
| InChIKey | OCRDUFPOFLFARD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |