C8H15F2NO — CID 164655200
4-amino-4-(2,2-difluoroethyl)cyclohexan-1-ol (PubChem CID 164655200) has the molecular formula C8H15F2NO and a molecular weight of 179.21 g/mol. Its IUPAC name is 4-amino-4-(2,2-difluoroethyl)cyclohexan-1-ol.
| Compound Name | 4-amino-4-(2,2-difluoroethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 164655200 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 4-amino-4-(2,2-difluoroethyl)cyclohexan-1-ol |
| SMILES | NC1(CC(F)F)CCC(O)CC1 |
| InChI | InChI=1S/C8H15F2NO/c9-7(10)5-8(11)3-1-6(12)2-4-8/h6-7,12H,1-5,11H2 |
| InChIKey | MGCKNUCYWJWWLU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |