C20H22N4O2 — CID 11501187
2-(4-(piperidin-4-ylmethoxy)phenyl)-1H-benzo[d]imidazole-5-carboxamide (PubChem CID 11501187) has the molecular formula C20H22N4O2 and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-[4-(piperidin-4-ylmethoxy)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(4-(piperidin-4-ylmethoxy)phenyl)-1H-benzo[d]imidazole-5-carboxamide |
|---|---|
| PubChem CID | 11501187 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-[4-(piperidin-4-ylmethoxy)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | C1CNCCC1COC2=CC=C(C=C2)C3=NC4=C(N3)C=C(C=C4)C(=O)N |
| InChI | InChI=1S/C20H22N4O2/c21-19(25)15-3-6-17-18(11-15)24-20(23-17)14-1-4-16(5-2-14)26-12-13-7-9-22-10-8-13/h1-6,11,13,22H,7-10,12H2,(H2,21,25)(H,23,24) |
| InChIKey | UAGGEYIEZHEDQH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | 474 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |