About 3-thiabicyclo[3.3.1]nonane-7,9-diol
3-thiabicyclo[3.3.1]nonane-7,9-diol (PubChem CID 115014386) has the molecular formula C8H14O2S
and a molecular weight of 174.26 g/mol. Its IUPAC name is 3-thiabicyclo[3.3.1]nonane-7,9-diol.
Molecular Properties
| Compound Name | 3-thiabicyclo[3.3.1]nonane-7,9-diol |
| PubChem CID | 115014386 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 3-thiabicyclo[3.3.1]nonane-7,9-diol |
| SMILES | OC1CC2CSCC(C1)C2O |
| InChI | InChI=1S/C8H14O2S/c9-7-1-5-3-11-4-6(2-7)8(5)10/h5-10H,1-4H2 |
| InChIKey | ZECHTYAEFDXPDU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-thiabicyclo[3.3.1]nonane-7,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiabicyclo[3.3.1]nonane-7,9-diol?
The IUPAC name of 3-thiabicyclo[3.3.1]nonane-7,9-diol (CID 115014386) is 3-thiabicyclo[3.3.1]nonane-7,9-diol.
What is the SMILES notation for 3-thiabicyclo[3.3.1]nonane-7,9-diol?
The canonical SMILES for 3-thiabicyclo[3.3.1]nonane-7,9-diol is OC1CC2CSCC(C1)C2O.
What is the InChIKey of 3-thiabicyclo[3.3.1]nonane-7,9-diol?
The InChIKey is ZECHTYAEFDXPDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2S/c9-7-1-5-3-11-4-6(2-7)8(5)10/h5-10H,1-4H2.
What are the key properties of 3-thiabicyclo[3.3.1]nonane-7,9-diol?
3-thiabicyclo[3.3.1]nonane-7,9-diol has a molecular weight of 174.26 g/mol, XLogP of 0.48, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiabicyclo[3.3.1]nonane-7,9-diol is sourced from PubChem (CID 115014386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).