C8H14O4S — CID 115024694
3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonane-7,9-diol (PubChem CID 115024694) has the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. Its IUPAC name is 3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonane-7,9-diol.
| Compound Name | 3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonane-7,9-diol |
|---|---|
| PubChem CID | 115024694 |
| Molecular Formula | C8H14O4S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonane-7,9-diol |
| SMILES | O=S1(=O)CC2CC(O)CC(C1)C2O |
| InChI | InChI=1S/C8H14O4S/c9-7-1-5-3-13(11,12)4-6(2-7)8(5)10/h5-10H,1-4H2 |
| InChIKey | AWRODGOAKVECAK-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |