C8H12F2O3S — CID 115035491
7,7-difluoro-3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonan-9-ol (PubChem CID 115035491) has the molecular formula C8H12F2O3S and a molecular weight of 226.24 g/mol. Its IUPAC name is 7,7-difluoro-3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonan-9-ol.
| Compound Name | 7,7-difluoro-3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 115035491 |
| Molecular Formula | C8H12F2O3S |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 7,7-difluoro-3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonan-9-ol |
| SMILES | O=S1(=O)CC2CC(F)(F)CC(C1)C2O |
| InChI | InChI=1S/C8H12F2O3S/c9-8(10)1-5-3-14(12,13)4-6(2-8)7(5)11/h5-7,11H,1-4H2 |
| InChIKey | BLEZBFIAJNBKTL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |