C10H18O3S — CID 115030940
7,7-dimethyl-3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonan-9-ol (PubChem CID 115030940) has the molecular formula C10H18O3S and a molecular weight of 218.32 g/mol. Its IUPAC name is 7,7-dimethyl-3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonan-9-ol.
| Compound Name | 7,7-dimethyl-3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 115030940 |
| Molecular Formula | C10H18O3S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 7,7-dimethyl-3,3-dioxo-3λ6-thiabicyclo[3.3.1]nonan-9-ol |
| SMILES | CC1(C)CC2CS(=O)(=O)CC(C1)C2O |
| InChI | InChI=1S/C10H18O3S/c1-10(2)3-7-5-14(12,13)6-8(4-10)9(7)11/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | LFXOVTKCSLMAGB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |