C13H26O3S — CID 158944127
thiolane 1,1-dioxide;2,4,6-trimethylcyclohexan-1-ol (PubChem CID 158944127) has the molecular formula C13H26O3S and a molecular weight of 262.41 g/mol. Its IUPAC name is thiolane 1,1-dioxide;2,4,6-trimethylcyclohexan-1-ol.
| Compound Name | thiolane 1,1-dioxide;2,4,6-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 158944127 |
| Molecular Formula | C13H26O3S |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | thiolane 1,1-dioxide;2,4,6-trimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)C(O)C(C)C1.O=S1(=O)CCCC1 |
| InChI | InChI=1S/C9H18O.C4H8O2S/c1-6-4-7(2)9(10)8(3)5-6;5-7(6)3-1-2-4-7/h6-10H,4-5H2,1-3H3;1-4H2 |
| InChIKey | JKPOLHQFKAEPII-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |