methyl 3-(3-hydroxypropyl)triazole-4-carboxylate

C7H11N3O3 — CID 115016837

IUPACmethyl 3-(3-hydroxypropyl)triazole-4-carboxylate
SMILESCOC(=O)c1cnnn1CCCO
InChIInChI=1S/C7H11N3O3/c1-13-7(12)6-5-8-9-10(6)3-2-4-11/h5,11H,2-4H2,1H3
InChIKeyZTOVGYCKJZPKDU-UHFFFAOYSA-N
MW185.18 g/mol
LogP-0.55
Rot. Bonds4

About methyl 3-(3-hydroxypropyl)triazole-4-carboxylate

methyl 3-(3-hydroxypropyl)triazole-4-carboxylate (PubChem CID 115016837) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is methyl 3-(3-hydroxypropyl)triazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 3-(3-hydroxypropyl)triazole-4-carboxylate
PubChem CID115016837
Molecular FormulaC7H11N3O3
Molecular Weight185.18 g/mol
Exact Mass185.08
IUPAC Namemethyl 3-(3-hydroxypropyl)triazole-4-carboxylate
SMILESCOC(=O)c1cnnn1CCCO
InChIInChI=1S/C7H11N3O3/c1-13-7(12)6-5-8-9-10(6)3-2-4-11/h5,11H,2-4H2,1H3
InChIKeyZTOVGYCKJZPKDU-UHFFFAOYSA-N
XLogP-0.55
TPSA77.24 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.18
LogP ≤ 5-0.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 3-(3-hydroxypropyl)triazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-hydroxypropyl)triazole-4-carboxylate?
The IUPAC name of methyl 3-(3-hydroxypropyl)triazole-4-carboxylate (CID 115016837) is methyl 3-(3-hydroxypropyl)triazole-4-carboxylate.
What is the SMILES notation for methyl 3-(3-hydroxypropyl)triazole-4-carboxylate?
The canonical SMILES for methyl 3-(3-hydroxypropyl)triazole-4-carboxylate is COC(=O)c1cnnn1CCCO.
What is the InChIKey of methyl 3-(3-hydroxypropyl)triazole-4-carboxylate?
The InChIKey is ZTOVGYCKJZPKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3/c1-13-7(12)6-5-8-9-10(6)3-2-4-11/h5,11H,2-4H2,1H3.
What are the key properties of methyl 3-(3-hydroxypropyl)triazole-4-carboxylate?
methyl 3-(3-hydroxypropyl)triazole-4-carboxylate has a molecular weight of 185.18 g/mol, XLogP of -0.55, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-hydroxypropyl)triazole-4-carboxylate is sourced from PubChem (CID 115016837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).