C12H19N3O8 — CID 11631347
methyl 3-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]triazole-4-carboxylate (PubChem CID 11631347) has the molecular formula C12H19N3O8 and a molecular weight of 333.30 g/mol. Its IUPAC name is methyl 3-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]triazole-4-carboxylate.
| Compound Name | methyl 3-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 11631347 |
| Molecular Formula | C12H19N3O8 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | methyl 3-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cnnn1CCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H19N3O8/c1-21-11(20)6-4-13-14-15(6)2-3-22-12-10(19)9(18)8(17)7(5-16)23-12/h4,7-10,12,16-19H,2-3,5H2,1H3/t7-,8-,9+,10+,12+/m1/s1 |
| InChIKey | HAFRHWIDFSQCBV-RWHSBRQSSA-N |
| XLogP | -3.12 |
| TPSA | 156.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |