C16H25NO8 — CID 23397604
1-[6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]pyrrole-2,5-dione (PubChem CID 23397604) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-[6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 23397604 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-[6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCCCCOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C16H25NO8/c18-9-10-13(21)14(22)15(23)16(25-10)24-8-4-2-1-3-7-17-11(19)5-6-12(17)20/h5-6,10,13-16,18,21-23H,1-4,7-9H2 |
| InChIKey | VMSDLVQMCWMKDK-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|