C11H9NO2 — CID 115017229
2-(4-methyl-1,3-oxazol-2-yl)benzaldehyde (PubChem CID 115017229) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 2-(4-methyl-1,3-oxazol-2-yl)benzaldehyde.
| Compound Name | 2-(4-methyl-1,3-oxazol-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 115017229 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 2-(4-methyl-1,3-oxazol-2-yl)benzaldehyde |
| SMILES | Cc1coc(-c2ccccc2C=O)n1 |
| InChI | InChI=1S/C11H9NO2/c1-8-7-14-11(12-8)10-5-3-2-4-9(10)6-13/h2-7H,1H3 |
| InChIKey | IHBAZKXQXFMWEX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|