C11H10N2O2 — CID 105454155
2-(2-amino-5-methyl-1,3-oxazol-4-yl)benzaldehyde (PubChem CID 105454155) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(2-amino-5-methyl-1,3-oxazol-4-yl)benzaldehyde.
| Compound Name | 2-(2-amino-5-methyl-1,3-oxazol-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 105454155 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-(2-amino-5-methyl-1,3-oxazol-4-yl)benzaldehyde |
| SMILES | Cc1oc(N)nc1-c1ccccc1C=O |
| InChI | InChI=1S/C11H10N2O2/c1-7-10(13-11(12)15-7)9-5-3-2-4-8(9)6-14/h2-6H,1H3,(H2,12,13) |
| InChIKey | JMEMLWSDHZJPOC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|