C12H11NO2 — CID 105453412
5-methyl-4-(2-methylphenyl)-1,3-oxazole-2-carbaldehyde (PubChem CID 105453412) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 5-methyl-4-(2-methylphenyl)-1,3-oxazole-2-carbaldehyde.
| Compound Name | 5-methyl-4-(2-methylphenyl)-1,3-oxazole-2-carbaldehyde |
|---|---|
| PubChem CID | 105453412 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 5-methyl-4-(2-methylphenyl)-1,3-oxazole-2-carbaldehyde |
| SMILES | Cc1ccccc1-c1nc(C=O)oc1C |
| InChI | InChI=1S/C12H11NO2/c1-8-5-3-4-6-10(8)12-9(2)15-11(7-14)13-12/h3-7H,1-2H3 |
| InChIKey | XOGWVTRIEAJVMB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|