C12H12HoNO2- — CID 178138249
carbanide;holmium;5-(2-methylphenyl)-1,2-oxazole-3-carbaldehyde (PubChem CID 178138249) has the molecular formula C12H12HoNO2- and a molecular weight of 367.16 g/mol. Its IUPAC name is carbanide;holmium;5-(2-methylphenyl)-1,2-oxazole-3-carbaldehyde.
| Compound Name | carbanide;holmium;5-(2-methylphenyl)-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 178138249 |
| Molecular Formula | C12H12HoNO2- |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | carbanide;holmium;5-(2-methylphenyl)-1,2-oxazole-3-carbaldehyde |
| SMILES | Cc1ccccc1-c1cc(C=O)no1.[CH3-].[Ho] |
| InChI | InChI=1S/C11H9NO2.CH3.Ho/c1-8-4-2-3-5-10(8)11-6-9(7-13)12-14-11;;/h2-7H,1H3;1H3;/q;-1; |
| InChIKey | HUTIALKONUSOCY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|