C12H13NO2 — CID 144767511
ethane;5-phenyl-1,2-oxazole-3-carbaldehyde (PubChem CID 144767511) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is ethane;5-phenyl-1,2-oxazole-3-carbaldehyde.
| Compound Name | ethane;5-phenyl-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 144767511 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | ethane;5-phenyl-1,2-oxazole-3-carbaldehyde |
| SMILES | CC.O=Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C10H7NO2.C2H6/c12-7-9-6-10(13-11-9)8-4-2-1-3-5-8;1-2/h1-7H;1-2H3 |
| InChIKey | SFJIXLMDGPCOHQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|