C22H15NO2 — CID 102390910
4-[2-(5-phenyl-1,2-oxazol-3-yl)phenyl]benzaldehyde (PubChem CID 102390910) has the molecular formula C22H15NO2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-[2-(5-phenyl-1,2-oxazol-3-yl)phenyl]benzaldehyde.
| Compound Name | 4-[2-(5-phenyl-1,2-oxazol-3-yl)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 102390910 |
| Molecular Formula | C22H15NO2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-[2-(5-phenyl-1,2-oxazol-3-yl)phenyl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2ccccc2-c2cc(-c3ccccc3)on2)cc1 |
| InChI | InChI=1S/C22H15NO2/c24-15-16-10-12-17(13-11-16)19-8-4-5-9-20(19)21-14-22(25-23-21)18-6-2-1-3-7-18/h1-15H |
| InChIKey | DTIWSUVDESOIHZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|