C10H7NO2S — CID 144767525
5-phenyl-1,2-oxazole-3-carbothioic S-acid (PubChem CID 144767525) has the molecular formula C10H7NO2S and a molecular weight of 205.24 g/mol. Its IUPAC name is 5-phenyl-1,2-oxazole-3-carbothioic S-acid.
| Compound Name | 5-phenyl-1,2-oxazole-3-carbothioic S-acid |
|---|---|
| PubChem CID | 144767525 |
| Molecular Formula | C10H7NO2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 5-phenyl-1,2-oxazole-3-carbothioic S-acid |
| SMILES | O=C(S)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C10H7NO2S/c12-10(14)8-6-9(13-11-8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
| InChIKey | YIWGBDTUMMIYNQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|