C18H12N2O2 — CID 163201074
N-[3-phenyl-1-(5-phenyl-1,2-oxazol-3-yl)prop-2-ynylidene]hydroxylamine (PubChem CID 163201074) has the molecular formula C18H12N2O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is N-[3-phenyl-1-(5-phenyl-1,2-oxazol-3-yl)prop-2-ynylidene]hydroxylamine.
| Compound Name | N-[3-phenyl-1-(5-phenyl-1,2-oxazol-3-yl)prop-2-ynylidene]hydroxylamine |
|---|---|
| PubChem CID | 163201074 |
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[3-phenyl-1-(5-phenyl-1,2-oxazol-3-yl)prop-2-ynylidene]hydroxylamine |
| SMILES | ON=C(C#Cc1ccccc1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C18H12N2O2/c21-19-16(12-11-14-7-3-1-4-8-14)17-13-18(22-20-17)15-9-5-2-6-10-15/h1-10,13,21H |
| InChIKey | UYCYBWKINKAGBD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|