C16H10FNO2 — CID 10858449
(4-fluorophenyl)-(5-phenyl-1,2-oxazol-3-yl)methanone (PubChem CID 10858449) has the molecular formula C16H10FNO2 and a molecular weight of 267.26 g/mol. Its IUPAC name is (4-fluorophenyl)-(5-phenyl-1,2-oxazol-3-yl)methanone.
| Compound Name | (4-fluorophenyl)-(5-phenyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 10858449 |
| Molecular Formula | C16H10FNO2 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (4-fluorophenyl)-(5-phenyl-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1ccc(F)cc1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H10FNO2/c17-13-8-6-12(7-9-13)16(19)14-10-15(20-18-14)11-4-2-1-3-5-11/h1-10H |
| InChIKey | YGBBZWMMYWZXNN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |