C16H18N2O2 — CID 154098737
1-(5-phenyl-1,2-oxazol-3-yl)-2-piperidin-1-ylethanone (PubChem CID 154098737) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-(5-phenyl-1,2-oxazol-3-yl)-2-piperidin-1-ylethanone.
| Compound Name | 1-(5-phenyl-1,2-oxazol-3-yl)-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 154098737 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-(5-phenyl-1,2-oxazol-3-yl)-2-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCCCC1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H18N2O2/c19-15(12-18-9-5-2-6-10-18)14-11-16(20-17-14)13-7-3-1-4-8-13/h1,3-4,7-8,11H,2,5-6,9-10,12H2 |
| InChIKey | SYEDXTSAUVCRJX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |