C11H11NOS — CID 165479825
[5-(2-methylphenyl)-1,2-oxazol-3-yl]methanethiol (PubChem CID 165479825) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is [5-(2-methylphenyl)-1,2-oxazol-3-yl]methanethiol.
| Compound Name | [5-(2-methylphenyl)-1,2-oxazol-3-yl]methanethiol |
|---|---|
| PubChem CID | 165479825 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | [5-(2-methylphenyl)-1,2-oxazol-3-yl]methanethiol |
| SMILES | Cc1ccccc1-c1cc(CS)no1 |
| InChI | InChI=1S/C11H11NOS/c1-8-4-2-3-5-10(8)11-6-9(7-14)12-13-11/h2-6,14H,7H2,1H3 |
| InChIKey | ALKPMASWALONSW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|