C12H14N2O — CID 28808393
[5-(2,5-dimethylphenyl)-1,2-oxazol-3-yl]methanamine (PubChem CID 28808393) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is [5-(2,5-dimethylphenyl)-1,2-oxazol-3-yl]methanamine.
| Compound Name | [5-(2,5-dimethylphenyl)-1,2-oxazol-3-yl]methanamine |
|---|---|
| PubChem CID | 28808393 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | [5-(2,5-dimethylphenyl)-1,2-oxazol-3-yl]methanamine |
| SMILES | Cc1ccc(C)c(-c2cc(CN)no2)c1 |
| InChI | InChI=1S/C12H14N2O/c1-8-3-4-9(2)11(5-8)12-6-10(7-13)14-15-12/h3-6H,7,13H2,1-2H3 |
| InChIKey | CFMDNSBXKXBCSM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |