C11H10FNO2S — CID 165472079
[5-(2-fluoro-6-methoxyphenyl)-1,2-oxazol-3-yl]methanethiol (PubChem CID 165472079) has the molecular formula C11H10FNO2S and a molecular weight of 239.27 g/mol. Its IUPAC name is [5-(2-fluoro-6-methoxyphenyl)-1,2-oxazol-3-yl]methanethiol.
| Compound Name | [5-(2-fluoro-6-methoxyphenyl)-1,2-oxazol-3-yl]methanethiol |
|---|---|
| PubChem CID | 165472079 |
| Molecular Formula | C11H10FNO2S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | [5-(2-fluoro-6-methoxyphenyl)-1,2-oxazol-3-yl]methanethiol |
| SMILES | COc1cccc(F)c1-c1cc(CS)no1 |
| InChI | InChI=1S/C11H10FNO2S/c1-14-9-4-2-3-8(12)11(9)10-5-7(6-16)13-15-10/h2-5,16H,6H2,1H3 |
| InChIKey | ZZEZSAYAYFDRQG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|