C46H38O4 — CID 163215546
2-[2,3,4-tris(2-formylphenyl)-6-methyl-5-(2,3,4,5,6-pentamethylphenyl)phenyl]benzaldehyde (PubChem CID 163215546) has the molecular formula C46H38O4 and a molecular weight of 654.81 g/mol. Its IUPAC name is 2-[2,3,4-tris(2-formylphenyl)-6-methyl-5-(2,3,4,5,6-pentamethylphenyl)phenyl]benzaldehyde.
| Compound Name | 2-[2,3,4-tris(2-formylphenyl)-6-methyl-5-(2,3,4,5,6-pentamethylphenyl)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 163215546 |
| Molecular Formula | C46H38O4 |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 2-[2,3,4-tris(2-formylphenyl)-6-methyl-5-(2,3,4,5,6-pentamethylphenyl)phenyl]benzaldehyde |
| SMILES | Cc1c(C)c(C)c(-c2c(C)c(-c3ccccc3C=O)c(-c3ccccc3C=O)c(-c3ccccc3C=O)c2-c2ccccc2C=O)c(C)c1C |
| InChI | InChI=1S/C46H38O4/c1-27-28(2)30(4)41(31(5)29(27)3)43-32(6)42(37-19-11-7-15-33(37)23-47)44(38-20-12-8-16-34(38)24-48)46(40-22-14-10-18-36(40)26-50)45(43)39-21-13-9-17-35(39)25-49/h7-26H,1-6H3 |
| InChIKey | DKTDJZXRCBBJDW-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|