C9H18F2N2 — CID 115019045
4,4-difluoro-3-piperidin-3-ylbutan-1-amine (PubChem CID 115019045) has the molecular formula C9H18F2N2 and a molecular weight of 192.25 g/mol. Its IUPAC name is 4,4-difluoro-3-piperidin-3-ylbutan-1-amine.
| Compound Name | 4,4-difluoro-3-piperidin-3-ylbutan-1-amine |
|---|---|
| PubChem CID | 115019045 |
| Molecular Formula | C9H18F2N2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 4,4-difluoro-3-piperidin-3-ylbutan-1-amine |
| SMILES | NCCC(C(F)F)C1CCCNC1 |
| InChI | InChI=1S/C9H18F2N2/c10-9(11)8(3-4-12)7-2-1-5-13-6-7/h7-9,13H,1-6,12H2 |
| InChIKey | PDIQYBZLIQYBHY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |