C8H15F2N — CID 84716916
2-cyclopentyl-3,3-difluoropropan-1-amine (PubChem CID 84716916) has the molecular formula C8H15F2N and a molecular weight of 163.21 g/mol. Its IUPAC name is 2-cyclopentyl-3,3-difluoropropan-1-amine.
| Compound Name | 2-cyclopentyl-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 84716916 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 2-cyclopentyl-3,3-difluoropropan-1-amine |
| SMILES | NCC(C(F)F)C1CCCC1 |
| InChI | InChI=1S/C8H15F2N/c9-8(10)7(5-11)6-3-1-2-4-6/h6-8H,1-5,11H2 |
| InChIKey | OODKVPJUHGQRJJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |