C9H8FN3O — CID 115019286
3-(aminomethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one (PubChem CID 115019286) has the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. Its IUPAC name is 3-(aminomethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(aminomethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 115019286 |
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-(aminomethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one |
| SMILES | NCc1cnc2ccc(F)cn2c1=O |
| InChI | InChI=1S/C9H8FN3O/c10-7-1-2-8-12-4-6(3-11)9(14)13(8)5-7/h1-2,4-5H,3,11H2 |
| InChIKey | OXQRVTZUVKBMGE-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |