C8H15F2NS — CID 115020351
4,4-difluoro-3-(thiolan-3-yl)butan-1-amine (PubChem CID 115020351) has the molecular formula C8H15F2NS and a molecular weight of 195.28 g/mol. Its IUPAC name is 4,4-difluoro-3-(thiolan-3-yl)butan-1-amine.
| Compound Name | 4,4-difluoro-3-(thiolan-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 115020351 |
| Molecular Formula | C8H15F2NS |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 4,4-difluoro-3-(thiolan-3-yl)butan-1-amine |
| SMILES | NCCC(C(F)F)C1CCSC1 |
| InChI | InChI=1S/C8H15F2NS/c9-8(10)7(1-3-11)6-2-4-12-5-6/h6-8H,1-5,11H2 |
| InChIKey | ZYUXLRDQOGGINN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |