C11H13F2N — CID 115020982
3-(1-cyclopropyl-2,2-difluoroethyl)aniline (PubChem CID 115020982) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-(1-cyclopropyl-2,2-difluoroethyl)aniline.
| Compound Name | 3-(1-cyclopropyl-2,2-difluoroethyl)aniline |
|---|---|
| PubChem CID | 115020982 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-(1-cyclopropyl-2,2-difluoroethyl)aniline |
| SMILES | Nc1cccc(C(C(F)F)C2CC2)c1 |
| InChI | InChI=1S/C11H13F2N/c12-11(13)10(7-4-5-7)8-2-1-3-9(14)6-8/h1-3,6-7,10-11H,4-5,14H2 |
| InChIKey | RBBGTSUKRKSQNE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|