C8H10N2O4 — CID 115021305
3-(oxan-2-yl)-1,2,4-oxadiazole-5-carboxylic acid (PubChem CID 115021305) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 3-(oxan-2-yl)-1,2,4-oxadiazole-5-carboxylic acid.
| Compound Name | 3-(oxan-2-yl)-1,2,4-oxadiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115021305 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 3-(oxan-2-yl)-1,2,4-oxadiazole-5-carboxylic acid |
| SMILES | O=C(O)c1nc(C2CCCCO2)no1 |
| InChI | InChI=1S/C8H10N2O4/c11-8(12)7-9-6(10-14-7)5-3-1-2-4-13-5/h5H,1-4H2,(H,11,12) |
| InChIKey | AQUPUDVXBHDGKJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |