C11H13N3O — CID 115022985
N-[3-(aminomethyl)phenyl]-5-methyl-1,2-oxazol-4-amine (PubChem CID 115022985) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is N-[3-(aminomethyl)phenyl]-5-methyl-1,2-oxazol-4-amine.
| Compound Name | N-[3-(aminomethyl)phenyl]-5-methyl-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 115022985 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-[3-(aminomethyl)phenyl]-5-methyl-1,2-oxazol-4-amine |
| SMILES | Cc1oncc1Nc1cccc(CN)c1 |
| InChI | InChI=1S/C11H13N3O/c1-8-11(7-13-15-8)14-10-4-2-3-9(5-10)6-12/h2-5,7,14H,6,12H2,1H3 |
| InChIKey | ZOUHTATUJBDWCN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |