C13H15N3O2S — CID 63767784
2-[3-(aminomethyl)anilino]benzenesulfonamide (PubChem CID 63767784) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[3-(aminomethyl)anilino]benzenesulfonamide.
| Compound Name | 2-[3-(aminomethyl)anilino]benzenesulfonamide |
|---|---|
| PubChem CID | 63767784 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[3-(aminomethyl)anilino]benzenesulfonamide |
| SMILES | NCc1cccc(Nc2ccccc2S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H15N3O2S/c14-9-10-4-3-5-11(8-10)16-12-6-1-2-7-13(12)19(15,17)18/h1-8,16H,9,14H2,(H2,15,17,18) |
| InChIKey | LNQKPKMLIZFHJF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |