2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid

C8H10F2N2O2 — CID 115023238

IUPAC2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid
SMILESCCn1ncc(C)c1C(F)(F)C(=O)O
InChIInChI=1S/C8H10F2N2O2/c1-3-12-6(5(2)4-11-12)8(9,10)7(13)14/h4H,3H2,1-2H3,(H,13,14)
InChIKeyWCLBGQXZGXOSIN-UHFFFAOYSA-N
MW204.18 g/mol
LogP1.39
Rot. Bonds3

About 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid

2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid (PubChem CID 115023238) has the molecular formula C8H10F2N2O2 and a molecular weight of 204.18 g/mol. Its IUPAC name is 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid.

Molecular Properties

Compound Name2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid
PubChem CID115023238
Molecular FormulaC8H10F2N2O2
Molecular Weight204.18 g/mol
Exact Mass204.07
IUPAC Name2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid
SMILESCCn1ncc(C)c1C(F)(F)C(=O)O
InChIInChI=1S/C8H10F2N2O2/c1-3-12-6(5(2)4-11-12)8(9,10)7(13)14/h4H,3H2,1-2H3,(H,13,14)
InChIKeyWCLBGQXZGXOSIN-UHFFFAOYSA-N
XLogP1.39
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.18
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid?
The IUPAC name of 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid (CID 115023238) is 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid.
What is the SMILES notation for 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid?
The canonical SMILES for 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid is CCn1ncc(C)c1C(F)(F)C(=O)O.
What is the InChIKey of 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid?
The InChIKey is WCLBGQXZGXOSIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O2/c1-3-12-6(5(2)4-11-12)8(9,10)7(13)14/h4H,3H2,1-2H3,(H,13,14).
What are the key properties of 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid?
2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid has a molecular weight of 204.18 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethyl-4-methylpyrazol-5-yl)-2,2-difluoroacetic acid is sourced from PubChem (CID 115023238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).