8-fluoro-4-hydroxynaphthalene-1-carboxylic acid

C11H7FO3 — CID 115024417

IUPAC8-fluoro-4-hydroxynaphthalene-1-carboxylic acid
SMILESO=C(O)c1ccc(O)c2cccc(F)c12
InChIInChI=1S/C11H7FO3/c12-8-3-1-2-6-9(13)5-4-7(10(6)8)11(14)15/h1-5,13H,(H,14,15)
InChIKeyHLNYNPOFQXAFTL-UHFFFAOYSA-N
MW206.17 g/mol
LogP2.38
Rot. Bonds1

About 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid

8-fluoro-4-hydroxynaphthalene-1-carboxylic acid (PubChem CID 115024417) has the molecular formula C11H7FO3 and a molecular weight of 206.17 g/mol. Its IUPAC name is 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid.

Molecular Properties

Compound Name8-fluoro-4-hydroxynaphthalene-1-carboxylic acid
PubChem CID115024417
Molecular FormulaC11H7FO3
Molecular Weight206.17 g/mol
Exact Mass206.04
IUPAC Name8-fluoro-4-hydroxynaphthalene-1-carboxylic acid
SMILESO=C(O)c1ccc(O)c2cccc(F)c12
InChIInChI=1S/C11H7FO3/c12-8-3-1-2-6-9(13)5-4-7(10(6)8)11(14)15/h1-5,13H,(H,14,15)
InChIKeyHLNYNPOFQXAFTL-UHFFFAOYSA-N
XLogP2.38
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.17
LogP ≤ 52.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5,8-dihydroxynaphthalene-1-carboxylic acid
CID 68625233
8-chloro-5-hydroxynaphthalene-1-carboxylic acid
CID 139711349
4,5,8-trihydroxynaphthalene-1-carboxylic acid
CID 139775362
5-fluoro-4-hydroxynaphthalene-2-carboxylic acid
CID 105458353
5,6,7,8-tetrahydroxynaphthalene-1-carboxylic acid
CID 176912348
5-fluoro-1-iodooxynaphthalene-2-carboxylic acid
CID 174321414
7-fluoro-1H-indole-3-carboxylic acid
CID 28806320
4-fluoro-1,3-dihydroxyisoindole-2-carboxylic acid
CID 174609393
dicopper;tetrakis(2-fluorobenzoate);bis(2-fluorobenzoic acid)
CID 139036983
CID 175992554
CID 175992554
4-[(4-hydroxynaphthalen-1-yl)disulfanyl]naphthalene-1-carboxylic acid
CID 156822104
2-hydroxybenzoic acid;praseodymium
CID 87786006

Frequently Asked Questions

What is the IUPAC name of 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid?
The IUPAC name of 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid (CID 115024417) is 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid.
What is the SMILES notation for 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid?
The canonical SMILES for 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid is O=C(O)c1ccc(O)c2cccc(F)c12.
What is the InChIKey of 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid?
The InChIKey is HLNYNPOFQXAFTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7FO3/c12-8-3-1-2-6-9(13)5-4-7(10(6)8)11(14)15/h1-5,13H,(H,14,15).
What are the key properties of 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid?
8-fluoro-4-hydroxynaphthalene-1-carboxylic acid has a molecular weight of 206.17 g/mol, XLogP of 2.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-4-hydroxynaphthalene-1-carboxylic acid is sourced from PubChem (CID 115024417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).