C9H6FNO4 — CID 174609393
4-fluoro-1,3-dihydroxyisoindole-2-carboxylic acid (PubChem CID 174609393) has the molecular formula C9H6FNO4 and a molecular weight of 211.15 g/mol. Its IUPAC name is 4-fluoro-1,3-dihydroxyisoindole-2-carboxylic acid.
| Compound Name | 4-fluoro-1,3-dihydroxyisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 174609393 |
| Molecular Formula | C9H6FNO4 |
| Molecular Weight | 211.15 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 4-fluoro-1,3-dihydroxyisoindole-2-carboxylic acid |
| SMILES | O=C(O)n1c(O)c2cccc(F)c2c1O |
| InChI | InChI=1S/C9H6FNO4/c10-5-3-1-2-4-6(5)8(13)11(7(4)12)9(14)15/h1-3,12-13H,(H,14,15) |
| InChIKey | RDHKATVVJOSYNB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |